3-(4,7-dimethoxy-2H-1,3-benzodioxol-5-yl)-1-(3-methoxyphenyl)prop-2-en-1-one
Chemical Structure Depiction of
3-(4,7-dimethoxy-2H-1,3-benzodioxol-5-yl)-1-(3-methoxyphenyl)prop-2-en-1-one
3-(4,7-dimethoxy-2H-1,3-benzodioxol-5-yl)-1-(3-methoxyphenyl)prop-2-en-1-one
Compound characteristics
| Compound ID: | 8019-7595 |
| Compound Name: | 3-(4,7-dimethoxy-2H-1,3-benzodioxol-5-yl)-1-(3-methoxyphenyl)prop-2-en-1-one |
| Molecular Weight: | 342.35 |
| Molecular Formula: | C19 H18 O6 |
| Smiles: | COc1cccc(c1)C(/C=C/c1cc(c2c(c1OC)OCO2)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3072 |
| logD: | 3.3072 |
| logSw: | -3.4736 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.589 |
| InChI Key: | BCUUCVOMNSFJME-UHFFFAOYSA-N |