4-[(4-methoxyphenyl)diazenyl]-2-oxo-1,2,5lambda~5~-oxadiazole-3-carboxamide
Chemical Structure Depiction of
4-[(4-methoxyphenyl)diazenyl]-2-oxo-1,2,5lambda~5~-oxadiazole-3-carboxamide
4-[(4-methoxyphenyl)diazenyl]-2-oxo-1,2,5lambda~5~-oxadiazole-3-carboxamide
Compound characteristics
| Compound ID: | 8019-7672 |
| Compound Name: | 4-[(4-methoxyphenyl)diazenyl]-2-oxo-1,2,5lambda~5~-oxadiazole-3-carboxamide |
| Molecular Weight: | 263.21 |
| Molecular Formula: | C10 H9 N5 O4 |
| Smiles: | COc1ccc(cc1)/N=N/c1c(C(N)=O)[n+]([O-])on1 |
| Stereo: | ACHIRAL |
| logP: | 1.5803 |
| logD: | 1.5803 |
| logSw: | -1.8737 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 104.429 |
| InChI Key: | ZELWIPWWIGCKLH-UHFFFAOYSA-N |