3-methyl-6-oxo-N-phenyl-4-(thiophen-3-yl)-4,5,6,7-tetrahydrothieno[2,3-b]pyridine-2-carboxamide
Chemical Structure Depiction of
3-methyl-6-oxo-N-phenyl-4-(thiophen-3-yl)-4,5,6,7-tetrahydrothieno[2,3-b]pyridine-2-carboxamide
3-methyl-6-oxo-N-phenyl-4-(thiophen-3-yl)-4,5,6,7-tetrahydrothieno[2,3-b]pyridine-2-carboxamide
Compound characteristics
| Compound ID: | 8019-7930 |
| Compound Name: | 3-methyl-6-oxo-N-phenyl-4-(thiophen-3-yl)-4,5,6,7-tetrahydrothieno[2,3-b]pyridine-2-carboxamide |
| Molecular Weight: | 368.47 |
| Molecular Formula: | C19 H16 N2 O2 S2 |
| Smiles: | Cc1c2C(CC(Nc2sc1C(Nc1ccccc1)=O)=O)c1ccsc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.693 |
| logD: | 3.669 |
| logSw: | -3.9598 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.8 |
| InChI Key: | LQVPWVUQUIQJKX-CQSZACIVSA-N |