methyl 5-[(2S,3S,4S)-4-benzamido-3-hydroxythiolan-2-yl]pentanoate
					Chemical Structure Depiction of
methyl 5-[(2S,3S,4S)-4-benzamido-3-hydroxythiolan-2-yl]pentanoate
			methyl 5-[(2S,3S,4S)-4-benzamido-3-hydroxythiolan-2-yl]pentanoate
Compound characteristics
| Compound ID: | 8019-8490 | 
| Compound Name: | methyl 5-[(2S,3S,4S)-4-benzamido-3-hydroxythiolan-2-yl]pentanoate | 
| Molecular Weight: | 337.44 | 
| Molecular Formula: | C17 H23 N O4 S | 
| Smiles: | COC(CCCC[C@H]1[C@H]([C@@H](CS1)NC(c1ccccc1)=O)O)=O | 
| Stereo: | ABSOLUTE | 
| logP: | 1.9636 | 
| logD: | 1.9636 | 
| logSw: | -2.2749 | 
| Hydrogen bond acceptors count: | 7 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 61.222 | 
| InChI Key: | MKXMYDFBYDXTMK-FMKPAKJESA-N | 
 
				 
				