5-(1-hydroxyethylidene)-1,3-thiazinane-2,4,6-trione
Chemical Structure Depiction of
5-(1-hydroxyethylidene)-1,3-thiazinane-2,4,6-trione
5-(1-hydroxyethylidene)-1,3-thiazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 8019-8634 |
| Compound Name: | 5-(1-hydroxyethylidene)-1,3-thiazinane-2,4,6-trione |
| Molecular Weight: | 187.17 |
| Molecular Formula: | C6 H5 N O4 S |
| Smiles: | C/C(=C1/C(NC(=O)SC1=O)=O)O |
| Stereo: | ACHIRAL |
| logP: | -0.343 |
| logD: | -3.3504 |
| logSw: | -1.5063 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.763 |
| InChI Key: | LCWRKJHQBCUKMY-UHFFFAOYSA-N |