3-(3,4,5-trimethoxyphenyl)pentanedioic acid
Chemical Structure Depiction of
3-(3,4,5-trimethoxyphenyl)pentanedioic acid
3-(3,4,5-trimethoxyphenyl)pentanedioic acid
Compound characteristics
| Compound ID: | 8019-8652 |
| Compound Name: | 3-(3,4,5-trimethoxyphenyl)pentanedioic acid |
| Molecular Weight: | 298.29 |
| Molecular Formula: | C14 H18 O7 |
| Smiles: | COc1cc(cc(c1OC)OC)C(CC(O)=O)CC(O)=O |
| Stereo: | ACHIRAL |
| logP: | -0.4354 |
| logD: | -3.4935 |
| logSw: | -0.4996 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.984 |
| InChI Key: | XLJDNPGZFKBWJE-UHFFFAOYSA-N |