2-hydroxy-N-{2-[(2-methylphenyl)carbamoyl]phenyl}benzamide
					Chemical Structure Depiction of
2-hydroxy-N-{2-[(2-methylphenyl)carbamoyl]phenyl}benzamide
			2-hydroxy-N-{2-[(2-methylphenyl)carbamoyl]phenyl}benzamide
Compound characteristics
| Compound ID: | 8019-8699 | 
| Compound Name: | 2-hydroxy-N-{2-[(2-methylphenyl)carbamoyl]phenyl}benzamide | 
| Molecular Weight: | 346.38 | 
| Molecular Formula: | C21 H18 N2 O3 | 
| Smiles: | Cc1ccccc1NC(c1ccccc1NC(c1ccccc1O)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 3.9812 | 
| logD: | 3.8771 | 
| logSw: | -3.4007 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 3 | 
| Polar surface area: | 61.573 | 
| InChI Key: | HBLRBOHZRVDVEI-UHFFFAOYSA-N | 
 
				 
				