2-(2,4-dichlorophenoxy)-N-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-6-yl)acetamide
Chemical Structure Depiction of
2-(2,4-dichlorophenoxy)-N-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-6-yl)acetamide
2-(2,4-dichlorophenoxy)-N-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-6-yl)acetamide
Compound characteristics
| Compound ID: | 8019-8707 |
| Compound Name: | 2-(2,4-dichlorophenoxy)-N-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-6-yl)acetamide |
| Molecular Weight: | 367.19 |
| Molecular Formula: | C16 H12 Cl2 N2 O4 |
| Smiles: | C1C(Nc2cc(ccc2O1)NC(COc1ccc(cc1[Cl])[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9329 |
| logD: | 2.9329 |
| logSw: | -3.2263 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.972 |
| InChI Key: | JJISIXWJCCAORA-UHFFFAOYSA-N |