N-(2-methoxyphenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide
Chemical Structure Depiction of
N-(2-methoxyphenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide
N-(2-methoxyphenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide
Compound characteristics
| Compound ID: | 8019-9084 |
| Compound Name: | N-(2-methoxyphenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| Molecular Weight: | 285.3 |
| Molecular Formula: | C16 H15 N O4 |
| Smiles: | COc1ccccc1NC(c1ccc2c(c1)OCCO2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0341 |
| logD: | 2.0338 |
| logSw: | -2.8182 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.085 |
| InChI Key: | AOADHYHAZUBKAO-UHFFFAOYSA-N |