3-(2H-1,3-benzodioxol-5-yl)-6-(4-chlorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Chemical Structure Depiction of
3-(2H-1,3-benzodioxol-5-yl)-6-(4-chlorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
3-(2H-1,3-benzodioxol-5-yl)-6-(4-chlorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Compound characteristics
| Compound ID: | 8019-9211 |
| Compound Name: | 3-(2H-1,3-benzodioxol-5-yl)-6-(4-chlorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| Molecular Weight: | 356.79 |
| Molecular Formula: | C16 H9 Cl N4 O2 S |
| Smiles: | C1Oc2ccc(cc2O1)c1nnc2n1nc(c1ccc(cc1)[Cl])s2 |
| Stereo: | ACHIRAL |
| logP: | 4.2251 |
| logD: | 4.2251 |
| logSw: | -4.6483 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 50.837 |
| InChI Key: | ZHWBDCWZHNCZAR-UHFFFAOYSA-N |