4-(naphthalen-1-yl)-5-(propan-2-yl)-4H-1,2,4-triazole-3-thiol
Chemical Structure Depiction of
4-(naphthalen-1-yl)-5-(propan-2-yl)-4H-1,2,4-triazole-3-thiol
4-(naphthalen-1-yl)-5-(propan-2-yl)-4H-1,2,4-triazole-3-thiol
Compound characteristics
| Compound ID: | 8019-9220 |
| Compound Name: | 4-(naphthalen-1-yl)-5-(propan-2-yl)-4H-1,2,4-triazole-3-thiol |
| Molecular Weight: | 269.37 |
| Molecular Formula: | C15 H15 N3 S |
| Smiles: | CC(C)c1nnc(n1c1cccc2ccccc12)S |
| Stereo: | ACHIRAL |
| logP: | 3.6309 |
| logD: | 2.8161 |
| logSw: | -3.788 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.1568 |
| InChI Key: | UGCJQHJMIMTZRD-UHFFFAOYSA-N |