(2-fluoro-4-nitrophenyl)hydrazine
Chemical Structure Depiction of
(2-fluoro-4-nitrophenyl)hydrazine
(2-fluoro-4-nitrophenyl)hydrazine
Compound characteristics
| Compound ID: | 8019-9964 |
| Compound Name: | (2-fluoro-4-nitrophenyl)hydrazine |
| Molecular Weight: | 171.13 |
| Molecular Formula: | C6 H6 F N3 O2 |
| Smiles: | c1cc(c(cc1[N+]([O-])=O)F)NN |
| Stereo: | ACHIRAL |
| logP: | 1.1768 |
| logD: | 1.1295 |
| logSw: | -2.0307 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 67.649 |
| InChI Key: | HPCGUKRKBLHYJV-UHFFFAOYSA-N |