2-[3-(furan-2-yl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-8-methoxyquinoline
Chemical Structure Depiction of
2-[3-(furan-2-yl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-8-methoxyquinoline
2-[3-(furan-2-yl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-8-methoxyquinoline
Compound characteristics
| Compound ID: | 8020-0876 |
| Compound Name: | 2-[3-(furan-2-yl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-8-methoxyquinoline |
| Molecular Weight: | 349.37 |
| Molecular Formula: | C17 H11 N5 O2 S |
| Smiles: | COc1cccc2ccc(c3nn4c(c5ccco5)nnc4s3)nc12 |
| Stereo: | ACHIRAL |
| logP: | 3.0751 |
| logD: | 3.0751 |
| logSw: | -3.3993 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 59.032 |
| InChI Key: | OKPDYZCBJMIECH-UHFFFAOYSA-N |