6-(2,4-dichlorophenyl)-3-(3,4-dimethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Chemical Structure Depiction of
6-(2,4-dichlorophenyl)-3-(3,4-dimethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
6-(2,4-dichlorophenyl)-3-(3,4-dimethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Compound characteristics
| Compound ID: | 8020-0878 |
| Compound Name: | 6-(2,4-dichlorophenyl)-3-(3,4-dimethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| Molecular Weight: | 407.28 |
| Molecular Formula: | C17 H12 Cl2 N4 O2 S |
| Smiles: | COc1ccc(cc1OC)c1nnc2n1nc(c1ccc(cc1[Cl])[Cl])s2 |
| Stereo: | ACHIRAL |
| logP: | 4.472 |
| logD: | 4.472 |
| logSw: | -4.7675 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.982 |
| InChI Key: | MSPFMGICNPKZKN-UHFFFAOYSA-N |