2-[(2-aminophenyl)sulfanyl]-5-(morpholine-4-sulfonyl)-N-phenylbenzamide
Chemical Structure Depiction of
2-[(2-aminophenyl)sulfanyl]-5-(morpholine-4-sulfonyl)-N-phenylbenzamide
2-[(2-aminophenyl)sulfanyl]-5-(morpholine-4-sulfonyl)-N-phenylbenzamide
Compound characteristics
| Compound ID: | 8020-0891 |
| Compound Name: | 2-[(2-aminophenyl)sulfanyl]-5-(morpholine-4-sulfonyl)-N-phenylbenzamide |
| Molecular Weight: | 469.58 |
| Molecular Formula: | C23 H23 N3 O4 S2 |
| Smiles: | C1COCCN1S(c1ccc(c(c1)C(Nc1ccccc1)=O)Sc1ccccc1N)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6585 |
| logD: | 3.6584 |
| logSw: | -4.1034 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 82.774 |
| InChI Key: | IXDWTFLYMQGKAW-UHFFFAOYSA-N |