4-(5-chloro-1-benzofuran-2-yl)-6,8-dimethyl-2H-1-benzopyran-2-one
Chemical Structure Depiction of
4-(5-chloro-1-benzofuran-2-yl)-6,8-dimethyl-2H-1-benzopyran-2-one
4-(5-chloro-1-benzofuran-2-yl)-6,8-dimethyl-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | 8020-1132 |
| Compound Name: | 4-(5-chloro-1-benzofuran-2-yl)-6,8-dimethyl-2H-1-benzopyran-2-one |
| Molecular Weight: | 324.76 |
| Molecular Formula: | C19 H13 Cl O3 |
| Smiles: | Cc1cc(C)c2c(c1)C(=CC(=O)O2)c1cc2cc(ccc2o1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.6131 |
| logD: | 5.6131 |
| logSw: | -6.054 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.3513 |
| InChI Key: | RCKPYRBKLVMTSW-UHFFFAOYSA-N |