4-(5-fluoro-3-methyl-1-benzofuran-2-yl)-6-methyl-2H-1-benzopyran-2-one
Chemical Structure Depiction of
4-(5-fluoro-3-methyl-1-benzofuran-2-yl)-6-methyl-2H-1-benzopyran-2-one
4-(5-fluoro-3-methyl-1-benzofuran-2-yl)-6-methyl-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | 8020-1144 |
| Compound Name: | 4-(5-fluoro-3-methyl-1-benzofuran-2-yl)-6-methyl-2H-1-benzopyran-2-one |
| Molecular Weight: | 308.31 |
| Molecular Formula: | C19 H13 F O3 |
| Smiles: | Cc1ccc2c(c1)C(=CC(=O)O2)c1c(C)c2cc(ccc2o1)F |
| Stereo: | ACHIRAL |
| logP: | 4.6189 |
| logD: | 4.6189 |
| logSw: | -4.5106 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.9 |
| InChI Key: | OABZMAICLUUOTD-UHFFFAOYSA-N |