3-(3,4-dimethoxyphenyl)-7-ethoxy-2H-1-benzopyran-2-one
Chemical Structure Depiction of
3-(3,4-dimethoxyphenyl)-7-ethoxy-2H-1-benzopyran-2-one
3-(3,4-dimethoxyphenyl)-7-ethoxy-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | 8020-1173 |
| Compound Name: | 3-(3,4-dimethoxyphenyl)-7-ethoxy-2H-1-benzopyran-2-one |
| Molecular Weight: | 326.35 |
| Molecular Formula: | C19 H18 O5 |
| Smiles: | CCOc1ccc2C=C(C(=O)Oc2c1)c1ccc(c(c1)OC)OC |
| Stereo: | ACHIRAL |
| logP: | 3.3983 |
| logD: | 3.3983 |
| logSw: | -3.5938 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.273 |
| InChI Key: | PMRDWHNIDHGPMM-UHFFFAOYSA-N |