2-[(2-{[(3-bromo-4,5-dimethoxyphenyl)methyl]amino}ethyl)amino]ethan-1-ol--hydrogen chloride (1/2)
Chemical Structure Depiction of
2-[(2-{[(3-bromo-4,5-dimethoxyphenyl)methyl]amino}ethyl)amino]ethan-1-ol--hydrogen chloride (1/2)
2-[(2-{[(3-bromo-4,5-dimethoxyphenyl)methyl]amino}ethyl)amino]ethan-1-ol--hydrogen chloride (1/2)
Compound characteristics
| Compound ID: | 8020-1349 |
| Compound Name: | 2-[(2-{[(3-bromo-4,5-dimethoxyphenyl)methyl]amino}ethyl)amino]ethan-1-ol--hydrogen chloride (1/2) |
| Molecular Weight: | 406.14 |
| Molecular Formula: | C13 H21 Br N2 O3 |
| Salt: | 2HCl |
| Smiles: | [H]N(CCNCCO)Cc1cc(c(c(c1)[Br])OC)OC |
| Stereo: | ACHIRAL |
| logP: | 0.5007 |
| logD: | -2.1355 |
| logSw: | -1.3611 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 55.841 |
| InChI Key: | PAMCJFJGBHEZJB-UHFFFAOYSA-N |