N-(2,4-dimethylphenyl)-6-methyl-4-phenyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-6-methyl-4-phenyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
N-(2,4-dimethylphenyl)-6-methyl-4-phenyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | 8020-1676 |
| Compound Name: | N-(2,4-dimethylphenyl)-6-methyl-4-phenyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide |
| Molecular Weight: | 351.47 |
| Molecular Formula: | C20 H21 N3 O S |
| Smiles: | CC1=C(C(c2ccccc2)NC(N1)=S)C(Nc1ccc(C)cc1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6618 |
| logD: | 3.6495 |
| logSw: | -3.8297 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 45.068 |
| InChI Key: | SEAOPSCPAVQAPJ-GOSISDBHSA-N |