1-(2,5-dimethoxyphenyl)-3-nitro-1H-1,2,4-triazole
Chemical Structure Depiction of
1-(2,5-dimethoxyphenyl)-3-nitro-1H-1,2,4-triazole
1-(2,5-dimethoxyphenyl)-3-nitro-1H-1,2,4-triazole
Compound characteristics
| Compound ID: | 8020-2001 |
| Compound Name: | 1-(2,5-dimethoxyphenyl)-3-nitro-1H-1,2,4-triazole |
| Molecular Weight: | 250.21 |
| Molecular Formula: | C10 H10 N4 O4 |
| Smiles: | COc1ccc(c(c1)n1cnc(n1)[N+]([O-])=O)OC |
| Stereo: | ACHIRAL |
| logP: | 1.5452 |
| logD: | 1.5452 |
| logSw: | -1.9725 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 71.36 |
| InChI Key: | YJFSJKIAYGTIPP-UHFFFAOYSA-N |