6-ethyl-4-(7-methoxy-1-benzofuran-2-yl)-2H-1-benzopyran-2-one
Chemical Structure Depiction of
6-ethyl-4-(7-methoxy-1-benzofuran-2-yl)-2H-1-benzopyran-2-one
6-ethyl-4-(7-methoxy-1-benzofuran-2-yl)-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | 8020-2020 |
| Compound Name: | 6-ethyl-4-(7-methoxy-1-benzofuran-2-yl)-2H-1-benzopyran-2-one |
| Molecular Weight: | 320.34 |
| Molecular Formula: | C20 H16 O4 |
| Smiles: | CCc1ccc2c(c1)C(=CC(=O)O2)c1cc2cccc(c2o1)OC |
| Stereo: | ACHIRAL |
| logP: | 4.5143 |
| logD: | 4.5143 |
| logSw: | -4.7191 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.53 |
| InChI Key: | RFTWUXJLUHSONV-UHFFFAOYSA-N |