1-chloro-4-{[diethyl(oxo)-lambda~6~-sulfanylidene]amino}anthracene-9,10-dione
Chemical Structure Depiction of
1-chloro-4-{[diethyl(oxo)-lambda~6~-sulfanylidene]amino}anthracene-9,10-dione
1-chloro-4-{[diethyl(oxo)-lambda~6~-sulfanylidene]amino}anthracene-9,10-dione
Compound characteristics
| Compound ID: | 8020-2157 |
| Compound Name: | 1-chloro-4-{[diethyl(oxo)-lambda~6~-sulfanylidene]amino}anthracene-9,10-dione |
| Molecular Weight: | 361.85 |
| Molecular Formula: | C18 H16 Cl N O3 S |
| Smiles: | CCS(CC)(=Nc1ccc(c2C(c3ccccc3C(c12)=O)=O)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.5971 |
| logD: | 4.5971 |
| logSw: | -4.9812 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 51.032 |
| InChI Key: | ZCVDHQBOYBWLNV-UHFFFAOYSA-N |