ethyl 4-(dimethylamino)-8-fluoroquinoline-3-carboxylate
Chemical Structure Depiction of
ethyl 4-(dimethylamino)-8-fluoroquinoline-3-carboxylate
ethyl 4-(dimethylamino)-8-fluoroquinoline-3-carboxylate
Compound characteristics
| Compound ID: | 8020-2396 |
| Compound Name: | ethyl 4-(dimethylamino)-8-fluoroquinoline-3-carboxylate |
| Molecular Weight: | 262.28 |
| Molecular Formula: | C14 H15 F N2 O2 |
| Smiles: | CCOC(c1cnc2c(cccc2c1N(C)C)F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9135 |
| logD: | 2.9134 |
| logSw: | -3.0591 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.818 |
| InChI Key: | DTMRVLFRMSYJPH-UHFFFAOYSA-N |