N-{[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methyl}-N'-(2-fluorophenyl)urea
					Chemical Structure Depiction of
N-{[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methyl}-N'-(2-fluorophenyl)urea
			N-{[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methyl}-N'-(2-fluorophenyl)urea
Compound characteristics
| Compound ID: | 8020-3994 | 
| Compound Name: | N-{[3-(3-chlorophenyl)-1,2-oxazol-5-yl]methyl}-N'-(2-fluorophenyl)urea | 
| Molecular Weight: | 345.76 | 
| Molecular Formula: | C17 H13 Cl F N3 O2 | 
| Smiles: | C(c1cc(c2cccc(c2)[Cl])no1)NC(Nc1ccccc1F)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.4291 | 
| logD: | 4.4291 | 
| logSw: | -4.6381 | 
| Hydrogen bond acceptors count: | 4 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 53.871 | 
| InChI Key: | UINGWFNHEGVOIP-UHFFFAOYSA-N | 
 
				 
				