3-(4-ethoxyphenyl)-6-methyl[1,2]oxazolo[5,4-d]pyrimidin-4(5H)-one
Chemical Structure Depiction of
3-(4-ethoxyphenyl)-6-methyl[1,2]oxazolo[5,4-d]pyrimidin-4(5H)-one
3-(4-ethoxyphenyl)-6-methyl[1,2]oxazolo[5,4-d]pyrimidin-4(5H)-one
Compound characteristics
| Compound ID: | 8020-4419 |
| Compound Name: | 3-(4-ethoxyphenyl)-6-methyl[1,2]oxazolo[5,4-d]pyrimidin-4(5H)-one |
| Molecular Weight: | 271.27 |
| Molecular Formula: | C14 H13 N3 O3 |
| Smiles: | CCOc1ccc(cc1)c1c2C(NC(C)=Nc2on1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.7992 |
| logD: | 1.7951 |
| logSw: | -2.4133 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.321 |
| InChI Key: | PWZRJBOSTTWZNK-UHFFFAOYSA-N |