N-(1-butylpyridin-2(1H)-ylidene)-N'-(prop-2-en-1-yl)thiourea
Chemical Structure Depiction of
N-(1-butylpyridin-2(1H)-ylidene)-N'-(prop-2-en-1-yl)thiourea
N-(1-butylpyridin-2(1H)-ylidene)-N'-(prop-2-en-1-yl)thiourea
Compound characteristics
| Compound ID: | 8020-4639 |
| Compound Name: | N-(1-butylpyridin-2(1H)-ylidene)-N'-(prop-2-en-1-yl)thiourea |
| Molecular Weight: | 249.38 |
| Molecular Formula: | C13 H19 N3 S |
| Smiles: | CCCCN1C=CC=C\C1=N/C(NCC=C)=S |
| Stereo: | ACHIRAL |
| logP: | 2.5795 |
| logD: | -3.0862 |
| logSw: | -2.6036 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.6473 |
| InChI Key: | YCBSPAHOVWTVKL-UHFFFAOYSA-N |