4-(4-fluorophenyl)-7-(3-methoxyphenyl)-3-methyl-6,7-dihydro[1,3]thiazolo[4,5-b]pyridine-2,5(3H,4H)-dione
Chemical Structure Depiction of
4-(4-fluorophenyl)-7-(3-methoxyphenyl)-3-methyl-6,7-dihydro[1,3]thiazolo[4,5-b]pyridine-2,5(3H,4H)-dione
4-(4-fluorophenyl)-7-(3-methoxyphenyl)-3-methyl-6,7-dihydro[1,3]thiazolo[4,5-b]pyridine-2,5(3H,4H)-dione
Compound characteristics
| Compound ID: | 8020-4719 |
| Compound Name: | 4-(4-fluorophenyl)-7-(3-methoxyphenyl)-3-methyl-6,7-dihydro[1,3]thiazolo[4,5-b]pyridine-2,5(3H,4H)-dione |
| Molecular Weight: | 384.43 |
| Molecular Formula: | C20 H17 F N2 O3 S |
| Smiles: | CN1C2=C(C(CC(N2c2ccc(cc2)F)=O)c2cccc(c2)OC)SC1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.846 |
| logD: | 3.846 |
| logSw: | -4.1267 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 38.735 |
| InChI Key: | SLNORHSVQGQFPH-MRXNPFEDSA-N |