4-methoxy-3-[(7-methoxy-2H-1,3-benzodioxol-5-yl)methyl]-4-oxobutanoic acid
Chemical Structure Depiction of
4-methoxy-3-[(7-methoxy-2H-1,3-benzodioxol-5-yl)methyl]-4-oxobutanoic acid
4-methoxy-3-[(7-methoxy-2H-1,3-benzodioxol-5-yl)methyl]-4-oxobutanoic acid
Compound characteristics
| Compound ID: | 8020-4799 |
| Compound Name: | 4-methoxy-3-[(7-methoxy-2H-1,3-benzodioxol-5-yl)methyl]-4-oxobutanoic acid |
| Molecular Weight: | 296.27 |
| Molecular Formula: | C14 H16 O7 |
| Smiles: | COC(C(CC(O)=O)Cc1cc(c2c(c1)OCO2)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.9317 |
| logD: | -2.0346 |
| logSw: | -1.5165 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.226 |
| InChI Key: | RVQVGCFGFOOLMA-SECBINFHSA-N |