1-tert-butyl-4-(4,7-dimethoxy-2H-1,3-benzodioxol-5-yl)-5-phenyl-4,4a,5,7-tetrahydroimidazo[4,5-b]pyrazolo[4,3-e]pyridin-6(1H)-one
Chemical Structure Depiction of
1-tert-butyl-4-(4,7-dimethoxy-2H-1,3-benzodioxol-5-yl)-5-phenyl-4,4a,5,7-tetrahydroimidazo[4,5-b]pyrazolo[4,3-e]pyridin-6(1H)-one
1-tert-butyl-4-(4,7-dimethoxy-2H-1,3-benzodioxol-5-yl)-5-phenyl-4,4a,5,7-tetrahydroimidazo[4,5-b]pyrazolo[4,3-e]pyridin-6(1H)-one
Compound characteristics
| Compound ID: | 8020-4981 |
| Compound Name: | 1-tert-butyl-4-(4,7-dimethoxy-2H-1,3-benzodioxol-5-yl)-5-phenyl-4,4a,5,7-tetrahydroimidazo[4,5-b]pyrazolo[4,3-e]pyridin-6(1H)-one |
| Molecular Weight: | 489.53 |
| Molecular Formula: | C26 H27 N5 O5 |
| Smiles: | CC(C)(C)n1c2c(cn1)C(C1C(NC(N1c1ccccc1)=O)=N2)c1cc(c2c(c1OC)OCO2)OC |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.676 |
| logD: | 3.6756 |
| logSw: | -3.7607 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.621 |
| InChI Key: | IJCFBPGPJOLKPS-UHFFFAOYSA-N |