4-acetyl-5-(4-ethoxyphenyl)-1-(3-ethoxypropyl)-3-hydroxy-1,5-dihydro-2H-pyrrol-2-one
Chemical Structure Depiction of
4-acetyl-5-(4-ethoxyphenyl)-1-(3-ethoxypropyl)-3-hydroxy-1,5-dihydro-2H-pyrrol-2-one
4-acetyl-5-(4-ethoxyphenyl)-1-(3-ethoxypropyl)-3-hydroxy-1,5-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | 8020-5098 |
| Compound Name: | 4-acetyl-5-(4-ethoxyphenyl)-1-(3-ethoxypropyl)-3-hydroxy-1,5-dihydro-2H-pyrrol-2-one |
| Molecular Weight: | 347.41 |
| Molecular Formula: | C19 H25 N O5 |
| Smiles: | CCOCCCN1C(C(=C(C1=O)O)C(C)=O)c1ccc(cc1)OCC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.8536 |
| logD: | 1.8518 |
| logSw: | -2.2411 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.537 |
| InChI Key: | BLNWEFBQTTWORY-KRWDZBQOSA-N |