5-(thiophen-3-yl)-2-[3-(trifluoromethyl)anilino]pyrido[2,3-d]pyrimidin-4(3H)-one
Chemical Structure Depiction of
5-(thiophen-3-yl)-2-[3-(trifluoromethyl)anilino]pyrido[2,3-d]pyrimidin-4(3H)-one
5-(thiophen-3-yl)-2-[3-(trifluoromethyl)anilino]pyrido[2,3-d]pyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | 8020-5183 |
| Compound Name: | 5-(thiophen-3-yl)-2-[3-(trifluoromethyl)anilino]pyrido[2,3-d]pyrimidin-4(3H)-one |
| Molecular Weight: | 388.37 |
| Molecular Formula: | C18 H11 F3 N4 O S |
| Smiles: | c1cc(cc(c1)NC1NC(c2c(ccnc2N=1)c1ccsc1)=O)C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 4.7571 |
| logD: | 4.7463 |
| logSw: | -4.8537 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.928 |
| InChI Key: | DBALIBYCTGZUQP-UHFFFAOYSA-N |