2-(1-methyl-5-nitro-1H-benzimidazol-2-yl)ethan-1-amine
Chemical Structure Depiction of
2-(1-methyl-5-nitro-1H-benzimidazol-2-yl)ethan-1-amine
2-(1-methyl-5-nitro-1H-benzimidazol-2-yl)ethan-1-amine
Compound characteristics
| Compound ID: | 8020-5446 |
| Compound Name: | 2-(1-methyl-5-nitro-1H-benzimidazol-2-yl)ethan-1-amine |
| Molecular Weight: | 220.23 |
| Molecular Formula: | C10 H12 N4 O2 |
| Smiles: | Cn1c2ccc(cc2nc1CCN)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 0.7035 |
| logD: | -1.0227 |
| logSw: | -1.7586 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.762 |
| InChI Key: | RJBVJUGPTJLDHO-UHFFFAOYSA-N |