2-amino-4-(2,4-dimethoxyphenyl)-7-methoxy-4H-1-benzopyran-3-carbonitrile
Chemical Structure Depiction of
2-amino-4-(2,4-dimethoxyphenyl)-7-methoxy-4H-1-benzopyran-3-carbonitrile
2-amino-4-(2,4-dimethoxyphenyl)-7-methoxy-4H-1-benzopyran-3-carbonitrile
Compound characteristics
| Compound ID: | 8020-6701 |
| Compound Name: | 2-amino-4-(2,4-dimethoxyphenyl)-7-methoxy-4H-1-benzopyran-3-carbonitrile |
| Molecular Weight: | 338.36 |
| Molecular Formula: | C19 H18 N2 O4 |
| Smiles: | COc1ccc(C2C(C#N)=C(N)Oc3cc(ccc23)OC)c(c1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8571 |
| logD: | 2.8571 |
| logSw: | -3.3025 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 69.012 |
| InChI Key: | KQVODHYSXREVKR-GOSISDBHSA-N |