7-oxo-7lambda~5~-benzo[a]phenazine-5,6-dione
Chemical Structure Depiction of
7-oxo-7lambda~5~-benzo[a]phenazine-5,6-dione
7-oxo-7lambda~5~-benzo[a]phenazine-5,6-dione
Compound characteristics
| Compound ID: | 8020-6765 |
| Compound Name: | 7-oxo-7lambda~5~-benzo[a]phenazine-5,6-dione |
| Molecular Weight: | 276.25 |
| Molecular Formula: | C16 H8 N2 O3 |
| Smiles: | c1ccc2c(c1)C(C(c1c2nc2ccccc2[n+]1[O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3457 |
| logD: | 2.3457 |
| logSw: | -2.789 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.828 |
| InChI Key: | VLHDETLTMABLJG-UHFFFAOYSA-N |