2-(4-fluoroanilino)naphthalene-1,4-dione
Chemical Structure Depiction of
2-(4-fluoroanilino)naphthalene-1,4-dione
2-(4-fluoroanilino)naphthalene-1,4-dione
Compound characteristics
| Compound ID: | 8020-7784 |
| Compound Name: | 2-(4-fluoroanilino)naphthalene-1,4-dione |
| Molecular Weight: | 267.26 |
| Molecular Formula: | C16 H10 F N O2 |
| Smiles: | C1=C(C(c2ccccc2C1=O)=O)Nc1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 3.4252 |
| logD: | 3.4235 |
| logSw: | -4.1957 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.429 |
| InChI Key: | ZOXJEXYGNDMQLG-UHFFFAOYSA-N |