2-amino-4-phenylbut-1-ene-1,1,3-tricarbonitrile
Chemical Structure Depiction of
2-amino-4-phenylbut-1-ene-1,1,3-tricarbonitrile
2-amino-4-phenylbut-1-ene-1,1,3-tricarbonitrile
Compound characteristics
| Compound ID: | 8020-8157 |
| Compound Name: | 2-amino-4-phenylbut-1-ene-1,1,3-tricarbonitrile |
| Molecular Weight: | 222.25 |
| Molecular Formula: | C13 H10 N4 |
| Smiles: | C(C(C#N)C(=C(C#N)C#N)N)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.9638 |
| logD: | 1.9627 |
| logSw: | -1.7179 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.549 |
| InChI Key: | ZCLXECYWOINQSN-LLVKDONJSA-N |