N-(4-fluoro-3-nitrophenyl)-3-(4-hydroxy-6-methyl-2-oxo-2H-pyran-3-yl)-3-(3,4,5-trimethoxyphenyl)propanamide
Chemical Structure Depiction of
N-(4-fluoro-3-nitrophenyl)-3-(4-hydroxy-6-methyl-2-oxo-2H-pyran-3-yl)-3-(3,4,5-trimethoxyphenyl)propanamide
N-(4-fluoro-3-nitrophenyl)-3-(4-hydroxy-6-methyl-2-oxo-2H-pyran-3-yl)-3-(3,4,5-trimethoxyphenyl)propanamide
Compound characteristics
| Compound ID: | 8020-8351 |
| Compound Name: | N-(4-fluoro-3-nitrophenyl)-3-(4-hydroxy-6-methyl-2-oxo-2H-pyran-3-yl)-3-(3,4,5-trimethoxyphenyl)propanamide |
| Molecular Weight: | 502.45 |
| Molecular Formula: | C24 H23 F N2 O9 |
| Smiles: | CC1=CC(=C(C(CC(Nc2ccc(c(c2)[N+]([O-])=O)F)=O)c2cc(c(c(c2)OC)OC)OC)C(=O)O1)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.857 |
| logD: | -0.1347 |
| logSw: | -3.5287 |
| Hydrogen bond acceptors count: | 13 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 116.807 |
| InChI Key: | PZPIKWFOFSACEY-HNNXBMFYSA-N |