3-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1,2-oxazole
Chemical Structure Depiction of
3-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1,2-oxazole
3-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1,2-oxazole
Compound characteristics
| Compound ID: | 8020-8719 |
| Compound Name: | 3-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
| Molecular Weight: | 341.36 |
| Molecular Formula: | C19 H19 N O5 |
| Smiles: | COc1ccc(cc1)c1c(con1)c1cc(c(c(c1)OC)OC)OC |
| Stereo: | ACHIRAL |
| logP: | 3.536 |
| logD: | 3.536 |
| logSw: | -3.7479 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.488 |
| InChI Key: | LFUNITCJJRHWGR-UHFFFAOYSA-N |