4-amino-N-(2-{[(3,4-diethoxyphenyl)methyl]amino}ethyl)-1,2,5-oxadiazole-3-carboxamide--hydrogen chloride (1/1)
Chemical Structure Depiction of
4-amino-N-(2-{[(3,4-diethoxyphenyl)methyl]amino}ethyl)-1,2,5-oxadiazole-3-carboxamide--hydrogen chloride (1/1)
4-amino-N-(2-{[(3,4-diethoxyphenyl)methyl]amino}ethyl)-1,2,5-oxadiazole-3-carboxamide--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 8104-05154 |
| Compound Name: | 4-amino-N-(2-{[(3,4-diethoxyphenyl)methyl]amino}ethyl)-1,2,5-oxadiazole-3-carboxamide--hydrogen chloride (1/1) |
| Molecular Weight: | 385.85 |
| Molecular Formula: | C16 H23 N5 O4 |
| Salt: | HCl |
| Smiles: | [H]N(CCNC(c1c(N)non1)=O)Cc1ccc(c(c1)OCC)OCC |
| Stereo: | ACHIRAL |
| logP: | 0.3824 |
| logD: | -1.8016 |
| logSw: | -2.0721 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 107.878 |
| InChI Key: | OFALLCRGFXZULW-UHFFFAOYSA-N |