3-chloro-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide
Chemical Structure Depiction of
3-chloro-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide
3-chloro-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | 8124-0678 |
| Compound Name: | 3-chloro-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide |
| Molecular Weight: | 378.88 |
| Molecular Formula: | C21 H15 Cl N2 O S |
| Smiles: | Cc1ccc2c(c1)sc(c1ccc(cc1)NC(c1cccc(c1)[Cl])=O)n2 |
| Stereo: | ACHIRAL |
| logP: | 6.0965 |
| logD: | 6.0963 |
| logSw: | -6.1387 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.778 |
| InChI Key: | DXUCKDUECUXRNE-UHFFFAOYSA-N |