2-{[(4-iodophenyl)methyl]sulfanyl}-5-(4-methylphenyl)-1,3,4-oxadiazole
Chemical Structure Depiction of
2-{[(4-iodophenyl)methyl]sulfanyl}-5-(4-methylphenyl)-1,3,4-oxadiazole
2-{[(4-iodophenyl)methyl]sulfanyl}-5-(4-methylphenyl)-1,3,4-oxadiazole
Compound characteristics
| Compound ID: | 8126-1697 |
| Compound Name: | 2-{[(4-iodophenyl)methyl]sulfanyl}-5-(4-methylphenyl)-1,3,4-oxadiazole |
| Molecular Weight: | 408.26 |
| Molecular Formula: | C16 H13 I N2 O S |
| Smiles: | Cc1ccc(cc1)c1nnc(o1)SCc1ccc(cc1)I |
| Stereo: | ACHIRAL |
| logP: | 5.0384 |
| logD: | 5.0384 |
| logSw: | -4.663 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.0641 |
| InChI Key: | KNBWMVQYFBSGQA-UHFFFAOYSA-N |