2-(4-benzylpiperazin-1-yl)-7-phenyl-7,8-dihydroquinazolin-5(6H)-one
Chemical Structure Depiction of
2-(4-benzylpiperazin-1-yl)-7-phenyl-7,8-dihydroquinazolin-5(6H)-one
2-(4-benzylpiperazin-1-yl)-7-phenyl-7,8-dihydroquinazolin-5(6H)-one
Compound characteristics
| Compound ID: | 8137-0147 |
| Compound Name: | 2-(4-benzylpiperazin-1-yl)-7-phenyl-7,8-dihydroquinazolin-5(6H)-one |
| Molecular Weight: | 398.51 |
| Molecular Formula: | C25 H26 N4 O |
| Smiles: | C1C(Cc2c(cnc(n2)N2CCN(CC2)Cc2ccccc2)C1=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9777 |
| logD: | 3.8701 |
| logSw: | -4.0827 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.649 |
| InChI Key: | CRJKTXKMTOLPDU-OAQYLSRUSA-N |