N-([(4,6-dimethylpyrimidin-2-yl)amino]{[2-(1H-indol-3-yl)ethyl]amino}methylidene)-3,5-dimethoxybenzamide
Chemical Structure Depiction of
N-([(4,6-dimethylpyrimidin-2-yl)amino]{[2-(1H-indol-3-yl)ethyl]amino}methylidene)-3,5-dimethoxybenzamide
N-([(4,6-dimethylpyrimidin-2-yl)amino]{[2-(1H-indol-3-yl)ethyl]amino}methylidene)-3,5-dimethoxybenzamide
Compound characteristics
| Compound ID: | 8137-0181 |
| Compound Name: | N-([(4,6-dimethylpyrimidin-2-yl)amino]{[2-(1H-indol-3-yl)ethyl]amino}methylidene)-3,5-dimethoxybenzamide |
| Molecular Weight: | 472.55 |
| Molecular Formula: | C26 H28 N6 O3 |
| Smiles: | Cc1cc(C)nc(NC(/NCCc2c[nH]c3ccccc23)=N/C(c2cc(cc(c2)OC)OC)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.7586 |
| logD: | 0.1553 |
| logSw: | -4.1198 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 85.969 |
| InChI Key: | ZQHPVGUCCGYOQC-UHFFFAOYSA-N |