1-(4-ethoxyphenyl)-3-{[1-(3-fluorobenzoyl)piperidin-4-yl]amino}pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-(4-ethoxyphenyl)-3-{[1-(3-fluorobenzoyl)piperidin-4-yl]amino}pyrrolidine-2,5-dione
1-(4-ethoxyphenyl)-3-{[1-(3-fluorobenzoyl)piperidin-4-yl]amino}pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | 8139-0175 |
| Compound Name: | 1-(4-ethoxyphenyl)-3-{[1-(3-fluorobenzoyl)piperidin-4-yl]amino}pyrrolidine-2,5-dione |
| Molecular Weight: | 439.49 |
| Molecular Formula: | C24 H26 F N3 O4 |
| Smiles: | CCOc1ccc(cc1)N1C(CC(C1=O)NC1CCN(CC1)C(c1cccc(c1)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7264 |
| logD: | 1.7164 |
| logSw: | -2.3492 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.214 |
| InChI Key: | ZIQDYONDGXTCIQ-NRFANRHFSA-N |