4-(methoxycarbonyl)phenyl 3-chloro-1-benzothiophene-2-carboxylate
Chemical Structure Depiction of
4-(methoxycarbonyl)phenyl 3-chloro-1-benzothiophene-2-carboxylate
4-(methoxycarbonyl)phenyl 3-chloro-1-benzothiophene-2-carboxylate
Compound characteristics
| Compound ID: | 8157-0258 |
| Compound Name: | 4-(methoxycarbonyl)phenyl 3-chloro-1-benzothiophene-2-carboxylate |
| Molecular Weight: | 346.79 |
| Molecular Formula: | C17 H11 Cl O4 S |
| Smiles: | COC(c1ccc(cc1)OC(c1c(c2ccccc2s1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0802 |
| logD: | 5.0802 |
| logSw: | -5.381 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 42.537 |
| InChI Key: | ZCSPAEGCFZOTFS-UHFFFAOYSA-N |