N-[2-(1,3-benzothiazol-2-yl)phenyl]-5-bromo-2-methoxybenzamide
Chemical Structure Depiction of
N-[2-(1,3-benzothiazol-2-yl)phenyl]-5-bromo-2-methoxybenzamide
N-[2-(1,3-benzothiazol-2-yl)phenyl]-5-bromo-2-methoxybenzamide
Compound characteristics
| Compound ID: | 8170-0358 |
| Compound Name: | N-[2-(1,3-benzothiazol-2-yl)phenyl]-5-bromo-2-methoxybenzamide |
| Molecular Weight: | 439.33 |
| Molecular Formula: | C21 H15 Br N2 O2 S |
| Smiles: | COc1ccc(cc1C(Nc1ccccc1c1nc2ccccc2s1)=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 5.894 |
| logD: | 5.8847 |
| logSw: | -5.5185 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.711 |
| InChI Key: | PMCRSZVEMWTRDB-UHFFFAOYSA-N |