N-[2-(4-butylphenyl)-6-chloro-2H-benzotriazol-5-yl]-3-methoxynaphthalene-2-carboxamide
Chemical Structure Depiction of
N-[2-(4-butylphenyl)-6-chloro-2H-benzotriazol-5-yl]-3-methoxynaphthalene-2-carboxamide
N-[2-(4-butylphenyl)-6-chloro-2H-benzotriazol-5-yl]-3-methoxynaphthalene-2-carboxamide
Compound characteristics
| Compound ID: | 8188-0499 |
| Compound Name: | N-[2-(4-butylphenyl)-6-chloro-2H-benzotriazol-5-yl]-3-methoxynaphthalene-2-carboxamide |
| Molecular Weight: | 484.99 |
| Molecular Formula: | C28 H25 Cl N4 O2 |
| Smiles: | CCCCc1ccc(cc1)n1nc2cc(c(cc2n1)[Cl])NC(c1cc2ccccc2cc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 8.2933 |
| logD: | 6.711 |
| logSw: | -6.6647 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.025 |
| InChI Key: | OABJGNQSLBQCRS-UHFFFAOYSA-N |