N-[3-(2,2-dimethylpropanamido)-4-methoxyphenyl]furan-2-carboxamide
Chemical Structure Depiction of
N-[3-(2,2-dimethylpropanamido)-4-methoxyphenyl]furan-2-carboxamide
N-[3-(2,2-dimethylpropanamido)-4-methoxyphenyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | 8188-1273 |
| Compound Name: | N-[3-(2,2-dimethylpropanamido)-4-methoxyphenyl]furan-2-carboxamide |
| Molecular Weight: | 316.35 |
| Molecular Formula: | C17 H20 N2 O4 |
| Smiles: | CC(C)(C)C(Nc1cc(ccc1OC)NC(c1ccco1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.669 |
| logD: | 2.6688 |
| logSw: | -3.1845 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.203 |
| InChI Key: | BPOYOMJYMBIUMI-UHFFFAOYSA-N |