1-(3-chloro-2-methylphenyl)-3-(4-ethoxyanilino)pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-(3-chloro-2-methylphenyl)-3-(4-ethoxyanilino)pyrrolidine-2,5-dione
1-(3-chloro-2-methylphenyl)-3-(4-ethoxyanilino)pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | 8191-1727 |
| Compound Name: | 1-(3-chloro-2-methylphenyl)-3-(4-ethoxyanilino)pyrrolidine-2,5-dione |
| Molecular Weight: | 358.82 |
| Molecular Formula: | C19 H19 Cl N2 O3 |
| Smiles: | CCOc1ccc(cc1)NC1CC(N(C1=O)c1cccc(c1C)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3928 |
| logD: | 3.3928 |
| logSw: | -3.5579 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.41 |
| InChI Key: | VOVBVJPTHDXMPZ-MRXNPFEDSA-N |